C18H25NO6 — CID 163689508
[(2S,3S,4S,5R)-5-acetyloxy-6-(2-aminophenoxy)-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 163689508) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-5-acetyloxy-6-(2-aminophenoxy)-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R)-5-acetyloxy-6-(2-aminophenoxy)-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163689508 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [(2S,3S,4S,5R)-5-acetyloxy-6-(2-aminophenoxy)-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Oc2ccccc2N)[C@H](OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C18H25NO6/c1-10-11(2)17(23-13(4)21)18(25-16(10)9-22-12(3)20)24-15-8-6-5-7-14(15)19/h5-8,10-11,16-18H,9,19H2,1-4H3/t10-,11-,16+,17+,18?/m0/s1 |
| InChIKey | UBJVJQGZBFVHFB-GKHFEUDJSA-N |
| XLogP | 2.14 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|