C21H25NO11 — CID 40814272
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-carbamoylphenoxy)oxan-2-yl]methyl acetate (PubChem CID 40814272) has the molecular formula C21H25NO11 and a molecular weight of 467.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-carbamoylphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-carbamoylphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 40814272 |
| Molecular Formula | C21H25NO11 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-carbamoylphenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Oc2ccccc2C(N)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H25NO11/c1-10(23)28-9-16-17(29-11(2)24)18(30-12(3)25)19(31-13(4)26)21(33-16)32-15-8-6-5-7-14(15)20(22)27/h5-8,16-19,21H,9H2,1-4H3,(H2,22,27)/t16-,17-,18+,19-,21+/m1/s1 |
| InChIKey | UUFPXZXXGUXZNE-YRIDSSQKSA-N |
| XLogP | 0.25 |
| TPSA | 166.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|