C28H32O10 — CID 12019986
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-methylphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 12019986) has the molecular formula C28H32O10 and a molecular weight of 528.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-methylphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-methylphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 12019986 |
| Molecular Formula | C28H32O10 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-methylphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccccc2Cc2ccc(C)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H32O10/c1-16-10-12-21(13-11-16)14-22-8-6-7-9-23(22)37-28-27(36-20(5)32)26(35-19(4)31)25(34-18(3)30)24(38-28)15-33-17(2)29/h6-13,24-28H,14-15H2,1-5H3/t24-,25-,26+,27-,28-/m1/s1 |
| InChIKey | SWKQQLPUTHSTLQ-RKFAPSRVSA-N |
| XLogP | 3.05 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|