C31H36O12 — CID 59711564
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 59711564) has the molecular formula C31H36O12 and a molecular weight of 600.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59711564 |
| Molecular Formula | C31H36O12 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccccc2Cc2ccc(O[C@@H]3CCOC3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H36O12/c1-18(32)37-17-27-28(38-19(2)33)29(39-20(3)34)30(40-21(4)35)31(43-27)42-26-8-6-5-7-23(26)15-22-9-11-24(12-10-22)41-25-13-14-36-16-25/h5-12,25,27-31H,13-17H2,1-4H3/t25-,27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | SFMUTGTUROPHQD-PLBNMZSOSA-N |
| XLogP | 2.91 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|