C21H28O8 — CID 163495145
[(3S,4S,6S)-5-acetyloxy-6-[2-(acetyloxymethyl)-4-tritiophenoxy]-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 163495145) has the molecular formula C21H28O8 and a molecular weight of 410.46 g/mol. Its IUPAC name is [(3S,4S,6S)-5-acetyloxy-6-[2-(acetyloxymethyl)-4-tritiophenoxy]-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6S)-5-acetyloxy-6-[2-(acetyloxymethyl)-4-tritiophenoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163495145 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [(3S,4S,6S)-5-acetyloxy-6-[2-(acetyloxymethyl)-4-tritiophenoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | [3H]c1ccc(O[C@@H]2OC(COC(C)=O)[C@@H](C)[C@H](C)C2OC(C)=O)c(COC(C)=O)c1 |
| InChI | InChI=1S/C21H28O8/c1-12-13(2)20(27-16(5)24)21(29-19(12)11-26-15(4)23)28-18-9-7-6-8-17(18)10-25-14(3)22/h6-9,12-13,19-21H,10-11H2,1-5H3/t12-,13-,19?,20?,21+/m0/s1/i6T |
| InChIKey | IIQGHRKSWRHOHG-SWFLNMTOSA-N |
| XLogP | 2.62 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|