C17H24O6 — CID 58275202
[(2S,3S,4S,5R,6S)-6-(2,3-dihydroxyphenoxy)-3,4,5-trimethyloxan-2-yl]methyl acetate (PubChem CID 58275202) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-6-(2,3-dihydroxyphenoxy)-3,4,5-trimethyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-6-(2,3-dihydroxyphenoxy)-3,4,5-trimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58275202 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-6-(2,3-dihydroxyphenoxy)-3,4,5-trimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cccc(O)c2O)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C17H24O6/c1-9-10(2)15(8-21-12(4)18)23-17(11(9)3)22-14-7-5-6-13(19)16(14)20/h5-7,9-11,15,17,19-20H,8H2,1-4H3/t9-,10-,11+,15+,17+/m0/s1 |
| InChIKey | NYCYUIKALRIXSX-IKNZIEOSSA-N |
| XLogP | 2.67 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|