C29H40O14 — CID 58275190
[(2S,3S,4S,5R,6R)-5-acetyloxy-6-[(2R,3S,4S,5R,6S)-5-acetyloxy-2-(acetyloxymethyl)-6-(2,3-dihydroxyphenoxy)-4-methyloxan-3-yl]oxy-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 58275190) has the molecular formula C29H40O14 and a molecular weight of 612.63 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-5-acetyloxy-6-[(2R,3S,4S,5R,6S)-5-acetyloxy-2-(acetyloxymethyl)-6-(2,3-dihydroxyphenoxy)-4-methyloxan-3-yl]oxy-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-5-acetyloxy-6-[(2R,3S,4S,5R,6S)-5-acetyloxy-2-(acetyloxymethyl)-6-(2,3-dihydroxyphenoxy)-4-methyloxan-3-yl]oxy-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58275190 |
| Molecular Formula | C29H40O14 |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-5-acetyloxy-6-[(2R,3S,4S,5R,6S)-5-acetyloxy-2-(acetyloxymethyl)-6-(2,3-dihydroxyphenoxy)-4-methyloxan-3-yl]oxy-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O[C@H]2[C@H](C)[C@@H](OC(C)=O)[C@H](Oc3cccc(O)c3O)O[C@@H]2COC(C)=O)[C@H](OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C29H40O14/c1-13-14(2)26(38-18(6)32)29(41-22(13)11-36-16(4)30)43-25-15(3)27(39-19(7)33)28(42-23(25)12-37-17(5)31)40-21-10-8-9-20(34)24(21)35/h8-10,13-15,22-23,25-29,34-35H,11-12H2,1-7H3/t13-,14-,15-,22+,23+,25-,26+,27+,28+,29+/m0/s1 |
| InChIKey | NPKLPNFUXZUKLA-XDRWCESLSA-N |
| XLogP | 2.21 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|