C21H23NO14 — CID 71262566
3-nitro-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybenzoic acid (PubChem CID 71262566) has the molecular formula C21H23NO14 and a molecular weight of 513.41 g/mol. Its IUPAC name is 3-nitro-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybenzoic acid.
| Compound Name | 3-nitro-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 71262566 |
| Molecular Formula | C21H23NO14 |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 3-nitro-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybenzoic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(C(=O)O)cc2[N+](=O)[O-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H23NO14/c1-9(23)31-8-16-17(32-10(2)24)18(33-11(3)25)19(34-12(4)26)21(36-16)35-15-6-5-13(20(27)28)7-14(15)22(29)30/h5-7,16-19,21H,8H2,1-4H3,(H,27,28)/t16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | DFONMKHKYRYRET-GQUPQBGVSA-N |
| XLogP | 0.75 |
| TPSA | 204.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|