C21H23NO13 — CID 122219989
[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 4-nitrobenzoate (PubChem CID 122219989) has the molecular formula C21H23NO13 and a molecular weight of 497.41 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 4-nitrobenzoate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 122219989 |
| Molecular Formula | C21H23NO13 |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 4-nitrobenzoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H23NO13/c1-10(23)30-9-16-17(31-11(2)24)18(32-12(3)25)19(33-13(4)26)21(34-16)35-20(27)14-5-7-15(8-6-14)22(28)29/h5-8,16-19,21H,9H2,1-4H3/t16-,17+,18+,19-,21+/m1/s1 |
| InChIKey | DPIYRFUWYARZTD-CWVBCOCOSA-N |
| XLogP | 0.83 |
| TPSA | 183.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|