C21H23NO14 — CID 166546045
[(2R,3S,4S,6S)-3,4,5-triacetyloxy-6-(4-nitrophenoxy)carbonyloxyoxan-2-yl]methyl acetate (PubChem CID 166546045) has the molecular formula C21H23NO14 and a molecular weight of 513.41 g/mol. Its IUPAC name is [(2R,3S,4S,6S)-3,4,5-triacetyloxy-6-(4-nitrophenoxy)carbonyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,6S)-3,4,5-triacetyloxy-6-(4-nitrophenoxy)carbonyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 166546045 |
| Molecular Formula | C21H23NO14 |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | [(2R,3S,4S,6S)-3,4,5-triacetyloxy-6-(4-nitrophenoxy)carbonyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(=O)Oc2ccc([N+](=O)[O-])cc2)C(OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H23NO14/c1-10(23)30-9-16-17(31-11(2)24)18(32-12(3)25)19(33-13(4)26)20(35-16)36-21(27)34-15-7-5-14(6-8-15)22(28)29/h5-8,16-20H,9H2,1-4H3/t16-,17+,18+,19?,20+/m1/s1 |
| InChIKey | VDNXOZJJIOFMSJ-WUQXUQHVSA-N |
| XLogP | 1.19 |
| TPSA | 193.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|