C27H27NO13 — CID 10099597
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-nitrobenzoyl)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 10099597) has the molecular formula C27H27NO13 and a molecular weight of 573.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-nitrobenzoyl)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-nitrobenzoyl)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10099597 |
| Molecular Formula | C27H27NO13 |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-nitrobenzoyl)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(C(=O)c3ccc([N+](=O)[O-])cc3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H27NO13/c1-14(29)36-13-22-24(37-15(2)30)25(38-16(3)31)26(39-17(4)32)27(41-22)40-21-11-7-19(8-12-21)23(33)18-5-9-20(10-6-18)28(34)35/h5-12,22,24-27H,13H2,1-4H3/t22-,24-,25+,26-,27-/m1/s1 |
| InChIKey | SSWJXXXMRKHIKM-UIKHAHSZSA-N |
| XLogP | 2.29 |
| TPSA | 183.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|