C18H21NO11 — CID 4138276
[3,4-diacetyloxy-5-hydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl acetate (PubChem CID 4138276) has the molecular formula C18H21NO11 and a molecular weight of 427.36 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-hydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-hydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 4138276 |
| Molecular Formula | C18H21NO11 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [3,4-diacetyloxy-5-hydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc([N+](=O)[O-])cc2)C(O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H21NO11/c1-9(20)26-8-14-16(27-10(2)21)17(28-11(3)22)15(23)18(30-14)29-13-6-4-12(5-7-13)19(24)25/h4-7,14-18,23H,8H2,1-3H3 |
| InChIKey | OIIXOWIQJYONGM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|