C32H41NO17 — CID 4306690
[3,4,5-triacetyloxy-6-[7-hydroxy-6-(4-nitrophenoxy)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-8-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 4306690) has the molecular formula C32H41NO17 and a molecular weight of 711.67 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[7-hydroxy-6-(4-nitrophenoxy)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-8-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[7-hydroxy-6-(4-nitrophenoxy)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-8-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 4306690 |
| Molecular Formula | C32H41NO17 |
| Molecular Weight | 711.67 g/mol |
| Exact Mass | 711.24 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[7-hydroxy-6-(4-nitrophenoxy)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-8-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC2C(O)C(Oc3ccc([N+](=O)[O-])cc3)OC3COC4(CCCCC4)OC32)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C32H41NO17/c1-16(34)41-14-22-25(43-17(2)35)28(44-18(3)36)29(45-19(4)37)31(48-22)49-27-24(38)30(46-21-10-8-20(9-11-21)33(39)40)47-23-15-42-32(50-26(23)27)12-6-5-7-13-32/h8-11,22-31,38H,5-7,12-15H2,1-4H3 |
| InChIKey | PFVIMOHQGFNKCN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 223.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.67 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|