C35H42O21 — CID 124901411
[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-formyl-2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 124901411) has the molecular formula C35H42O21 and a molecular weight of 798.70 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-formyl-2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-formyl-2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124901411 |
| Molecular Formula | C35H42O21 |
| Molecular Weight | 798.70 g/mol |
| Exact Mass | 798.22 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-formyl-2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](Oc2ccc(C=O)cc2O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C35H42O21/c1-15(37)45-13-26-28(47-17(3)39)30(49-19(5)41)32(51-21(7)43)34(55-26)53-24-10-9-23(12-36)11-25(24)54-35-33(52-22(8)44)31(50-20(6)42)29(48-18(4)40)27(56-35)14-46-16(2)38/h9-12,26-35H,13-14H2,1-8H3/t26-,27+,28-,29+,30+,31-,32-,33-,34-,35+/m0/s1 |
| InChIKey | JKFNRYAQWXFYIL-FKAVHLAGSA-N |
| XLogP | 0.42 |
| TPSA | 264.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.70 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|