C21H25NO12 — CID 140721781
[5-formyl-2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]-oxidoazanium (PubChem CID 140721781) has the molecular formula C21H25NO12 and a molecular weight of 483.43 g/mol. Its IUPAC name is [5-formyl-2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]-oxidoazanium.
| Compound Name | [5-formyl-2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]-oxidoazanium |
|---|---|
| PubChem CID | 140721781 |
| Molecular Formula | C21H25NO12 |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | [5-formyl-2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]-oxidoazanium |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(C=O)cc2[NH2+][O-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H25NO12/c1-10(24)29-9-17-18(30-11(2)25)19(31-12(3)26)20(32-13(4)27)21(34-17)33-16-6-5-14(8-23)7-15(16)22-28/h5-8,17-21H,9,22H2,1-4H3/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | ORDLURQARBMTBA-XDWAVFMPSA-N |
| XLogP | -0.35 |
| TPSA | 180.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|