C25H36N2O11 — CID 160903129
[(3S,4S,6S)-5-acetyloxy-3,4-dimethyl-6-[2-[2-[2-[(4-nitrobenzoyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 160903129) has the molecular formula C25H36N2O11 and a molecular weight of 540.57 g/mol. Its IUPAC name is [(3S,4S,6S)-5-acetyloxy-3,4-dimethyl-6-[2-[2-[2-[(4-nitrobenzoyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6S)-5-acetyloxy-3,4-dimethyl-6-[2-[2-[2-[(4-nitrobenzoyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 160903129 |
| Molecular Formula | C25H36N2O11 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [(3S,4S,6S)-5-acetyloxy-3,4-dimethyl-6-[2-[2-[2-[(4-nitrobenzoyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](OCCOCCOCCNC(=O)c2ccc([N+](=O)[O-])cc2)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C25H36N2O11/c1-16-17(2)23(37-19(4)29)25(38-22(16)15-36-18(3)28)35-14-13-34-12-11-33-10-9-26-24(30)20-5-7-21(8-6-20)27(31)32/h5-8,16-17,22-23,25H,9-15H2,1-4H3,(H,26,30)/t16-,17-,22?,23?,25-/m0/s1 |
| InChIKey | IVDNCLPHPTYIAW-MYOCEYHWSA-N |
| XLogP | 1.87 |
| TPSA | 161.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|