C26H36N2O14 — CID 164941067
[(3R,4R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 164941067) has the molecular formula C26H36N2O14 and a molecular weight of 600.57 g/mol. Its IUPAC name is [(3R,4R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 164941067 |
| Molecular Formula | C26H36N2O14 |
| Molecular Weight | 600.57 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | [(3R,4R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1[C@H](OCCOCCOCCOc2ccc([N+](=O)[O-])cc2)OC(COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H36N2O14/c1-16(29)27-23-25(41-19(4)32)24(40-18(3)31)22(15-39-17(2)30)42-26(23)38-14-12-36-10-9-35-11-13-37-21-7-5-20(6-8-21)28(33)34/h5-8,22-26H,9-15H2,1-4H3,(H,27,29)/t22?,23?,24-,25+,26+/m0/s1 |
| InChIKey | GKKWKCWIQKURRP-QFIOHLPESA-N |
| XLogP | 0.68 |
| TPSA | 197.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|