C18H31ClN2O10 — CID 169492935
[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(2-aminoethoxy)ethoxy]oxan-2-yl]methyl acetate;hydrochloride (PubChem CID 169492935) has the molecular formula C18H31ClN2O10 and a molecular weight of 470.90 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(2-aminoethoxy)ethoxy]oxan-2-yl]methyl acetate;hydrochloride.
| Compound Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(2-aminoethoxy)ethoxy]oxan-2-yl]methyl acetate;hydrochloride |
|---|---|
| PubChem CID | 169492935 |
| Molecular Formula | C18H31ClN2O10 |
| Molecular Weight | 470.90 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(2-aminoethoxy)ethoxy]oxan-2-yl]methyl acetate;hydrochloride |
| SMILES | CC(=O)N[C@H]1[C@H](OCCOCCN)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O.Cl |
| InChI | InChI=1S/C18H30N2O10.ClH/c1-10(21)20-15-17(29-13(4)24)16(28-12(3)23)14(9-27-11(2)22)30-18(15)26-8-7-25-6-5-19;/h14-18H,5-9,19H2,1-4H3,(H,20,21);1H/t14-,15-,16+,17-,18-;/m1./s1 |
| InChIKey | ANLJYADOYUQPSC-MFOMZMTJSA-N |
| XLogP | -0.94 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.90 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|