C19H32N2O10 — CID 130402689
[3,4-diacetyloxy-6-[2-(2-aminoethoxy)ethoxy]-5-(2-oxopropylamino)oxan-2-yl]methyl acetate (PubChem CID 130402689) has the molecular formula C19H32N2O10 and a molecular weight of 448.47 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-[2-(2-aminoethoxy)ethoxy]-5-(2-oxopropylamino)oxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-[2-(2-aminoethoxy)ethoxy]-5-(2-oxopropylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 130402689 |
| Molecular Formula | C19H32N2O10 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [3,4-diacetyloxy-6-[2-(2-aminoethoxy)ethoxy]-5-(2-oxopropylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)CNC1C(OCCOCCN)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H32N2O10/c1-11(22)9-21-16-18(30-14(4)25)17(29-13(3)24)15(10-28-12(2)23)31-19(16)27-8-7-26-6-5-20/h15-19,21H,5-10,20H2,1-4H3 |
| InChIKey | KBNBRJQGJLGALH-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|