C24H41NO14 — CID 118953030
[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 118953030) has the molecular formula C24H41NO14 and a molecular weight of 567.59 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118953030 |
| Molecular Formula | C24H41NO14 |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](OCCOCCOCCOCCOCCO)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H41NO14/c1-16(27)25-21-23(38-19(4)30)22(37-18(3)29)20(15-36-17(2)28)39-24(21)35-14-13-34-12-11-33-10-9-32-8-7-31-6-5-26/h20-24,26H,5-15H2,1-4H3,(H,25,27)/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | FMZPQVBVWVQVJF-GNADVCDUSA-N |
| XLogP | -1.28 |
| TPSA | 183.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|