C25H42N2O15 — CID 138632710
[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 138632710) has the molecular formula C25H42N2O15 and a molecular weight of 610.61 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138632710 |
| Molecular Formula | C25H42N2O15 |
| Molecular Weight | 610.61 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](OCCOCCOCCOCC(=O)NC(CO)CO)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H42N2O15/c1-15(30)26-22-24(41-18(4)33)23(40-17(3)32)20(13-39-16(2)31)42-25(22)38-10-9-36-6-5-35-7-8-37-14-21(34)27-19(11-28)12-29/h19-20,22-25,28-29H,5-14H2,1-4H3,(H,26,30)(H,27,34)/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | FLTZZXLDRRCQDD-PRDVQWLOSA-N |
| XLogP | -2.82 |
| TPSA | 223.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.61 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|