C22H38N2O12 — CID 162711211
[(2R,3R,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 162711211) has the molecular formula C22H38N2O12 and a molecular weight of 522.55 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162711211 |
| Molecular Formula | C22H38N2O12 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | [(2R,3R,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1C(OCCOCCOCCOCCN)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H38N2O12/c1-14(25)24-19-21(35-17(4)28)20(34-16(3)27)18(13-33-15(2)26)36-22(19)32-12-11-31-10-9-30-8-7-29-6-5-23/h18-22H,5-13,23H2,1-4H3,(H,24,25)/t18-,19-,20+,21-,22?/m1/s1 |
| InChIKey | OVBLTEBRLGHCJR-VEIQOZLZSA-N |
| XLogP | -1.33 |
| TPSA | 180.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|