C17H28N2O9 — CID 66559736
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-(3-aminopropoxy)oxan-2-yl]methyl acetate (PubChem CID 66559736) has the molecular formula C17H28N2O9 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-(3-aminopropoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-(3-aminopropoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66559736 |
| Molecular Formula | C17H28N2O9 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-(3-aminopropoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](OCCCN)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H28N2O9/c1-9(20)19-14-16(27-12(4)23)15(26-11(3)22)13(8-25-10(2)21)28-17(14)24-7-5-6-18/h13-17H,5-8,18H2,1-4H3,(H,19,20)/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | OMBHXOHSWNWOSN-WRQOLXDDSA-N |
| XLogP | -0.99 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|