C24H41N3O11 — CID 139428139
[5-acetamido-3,4-diacetyloxy-6-[2-[2-(6-aminohexanoylamino)ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 139428139) has the molecular formula C24H41N3O11 and a molecular weight of 547.60 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-[2-[2-(6-aminohexanoylamino)ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-[2-[2-(6-aminohexanoylamino)ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139428139 |
| Molecular Formula | C24H41N3O11 |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-[2-[2-(6-aminohexanoylamino)ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(OCCOCCNC(=O)CCCCCN)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C24H41N3O11/c1-15(28)27-21-23(37-18(4)31)22(36-17(3)30)19(14-35-16(2)29)38-24(21)34-13-12-33-11-10-26-20(32)8-6-5-7-9-25/h19,21-24H,5-14,25H2,1-4H3,(H,26,32)(H,27,28) |
| InChIKey | ZHAOIURDJBSGTB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 190.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|