C27H45N3O12 — CID 101243814
[(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 101243814) has the molecular formula C27H45N3O12 and a molecular weight of 603.67 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101243814 |
| Molecular Formula | C27H45N3O12 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.30 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OCCNC(=O)CCCCCNC(=O)OC(C)(C)C)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H45N3O12/c1-16(31)30-22-24(40-19(4)34)23(39-18(3)33)20(15-38-17(2)32)41-25(22)37-14-13-28-21(35)11-9-8-10-12-29-26(36)42-27(5,6)7/h20,22-25H,8-15H2,1-7H3,(H,28,35)(H,29,36)(H,30,31)/t20-,22-,23+,24-,25+/m1/s1 |
| InChIKey | BTFWOUMUXGNKPG-HFBCXCLPSA-N |
| XLogP | 0.86 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|