C23H37NO10 — CID 170271257
[5-acetamido-3,4-diacetyloxy-6-(6,6-dimethyl-5-oxoheptoxy)oxan-2-yl]methyl acetate (PubChem CID 170271257) has the molecular formula C23H37NO10 and a molecular weight of 487.55 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-(6,6-dimethyl-5-oxoheptoxy)oxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-(6,6-dimethyl-5-oxoheptoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 170271257 |
| Molecular Formula | C23H37NO10 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-(6,6-dimethyl-5-oxoheptoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(OCCCCC(=O)C(C)(C)C)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H37NO10/c1-13(25)24-19-21(33-16(4)28)20(32-15(3)27)17(12-31-14(2)26)34-22(19)30-11-9-8-10-18(29)23(5,6)7/h17,19-22H,8-12H2,1-7H3,(H,24,25) |
| InChIKey | SXNLNIHRFIEXMZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|