C19H31N3O10 — CID 153340477
[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(3-aminopropylamino)-2-oxoethoxy]oxan-2-yl]methyl acetate (PubChem CID 153340477) has the molecular formula C19H31N3O10 and a molecular weight of 461.47 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(3-aminopropylamino)-2-oxoethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(3-aminopropylamino)-2-oxoethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 153340477 |
| Molecular Formula | C19H31N3O10 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(3-aminopropylamino)-2-oxoethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](OCC(=O)NCCCN)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H31N3O10/c1-10(23)22-16-18(31-13(4)26)17(30-12(3)25)14(8-28-11(2)24)32-19(16)29-9-15(27)21-7-5-6-20/h14,16-19H,5-9,20H2,1-4H3,(H,21,27)(H,22,23)/t14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | QXYUDDUESWYAJO-IQZDNPOKSA-N |
| XLogP | -1.88 |
| TPSA | 181.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|