C19H31N3O10 — CID 175039258
[(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[2-(3-aminopropylamino)-2-oxoethoxy]oxan-2-yl]methyl acetate (PubChem CID 175039258) has the molecular formula C19H31N3O10 and a molecular weight of 461.47 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[2-(3-aminopropylamino)-2-oxoethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[2-(3-aminopropylamino)-2-oxoethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175039258 |
| Molecular Formula | C19H31N3O10 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[2-(3-aminopropylamino)-2-oxoethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCC(=O)NCCCN)[C@H](CC(N)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H31N3O10/c1-10(23)28-8-14-18(31-12(3)25)17(30-11(2)24)13(7-15(21)26)19(32-14)29-9-16(27)22-6-4-5-20/h13-14,17-19H,4-9,20H2,1-3H3,(H2,21,26)(H,22,27)/t13-,14-,17-,18+,19-/m1/s1 |
| InChIKey | RINMIYZEWHWTIU-XABSUIGJSA-N |
| XLogP | -1.89 |
| TPSA | 195.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|