C26H36N4O14 — CID 155573493
[(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[(6-nitropyridine-3-carbonyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 155573493) has the molecular formula C26H36N4O14 and a molecular weight of 628.59 g/mol. Its IUPAC name is [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[(6-nitropyridine-3-carbonyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[(6-nitropyridine-3-carbonyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155573493 |
| Molecular Formula | C26H36N4O14 |
| Molecular Weight | 628.59 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-[2-[(6-nitropyridine-3-carbonyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(OC(C)=O)[C@@H](OC(C)=O)C(COC(C)=O)O[C@H]1OCCOCCOCCNC(=O)c1ccc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C26H36N4O14/c1-15(31)29-22-24(43-18(4)34)23(42-17(3)33)20(14-41-16(2)32)44-26(22)40-12-11-39-10-9-38-8-7-27-25(35)19-5-6-21(28-13-19)30(36)37/h5-6,13,20,22-24,26H,7-12,14H2,1-4H3,(H,27,35)(H,29,31)/t20?,22?,23-,24?,26+/m0/s1 |
| InChIKey | UNPTZKYFALKOPG-AMZQVRQJSA-N |
| XLogP | -0.57 |
| TPSA | 230.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.59 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|