C27H38N2O12 — CID 155573509
[(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-(2-benzamidoethoxy)ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 155573509) has the molecular formula C27H38N2O12 and a molecular weight of 582.60 g/mol. Its IUPAC name is [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-(2-benzamidoethoxy)ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-(2-benzamidoethoxy)ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155573509 |
| Molecular Formula | C27H38N2O12 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[2-(2-benzamidoethoxy)ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(OC(C)=O)[C@@H](OC(C)=O)C(COC(C)=O)O[C@H]1OCCOCCOCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H38N2O12/c1-17(30)29-23-25(40-20(4)33)24(39-19(3)32)22(16-38-18(2)31)41-27(23)37-15-14-36-13-12-35-11-10-28-26(34)21-8-6-5-7-9-21/h5-9,22-25,27H,10-16H2,1-4H3,(H,28,34)(H,29,30)/t22?,23?,24-,25?,27+/m0/s1 |
| InChIKey | FRDHCGICNYTECK-UYWGYDAZSA-N |
| XLogP | 0.12 |
| TPSA | 174.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|