C30H45NO14 — CID 157364947
benzyl 2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]acetate;methane (PubChem CID 157364947) has the molecular formula C30H45NO14 and a molecular weight of 643.68 g/mol. Its IUPAC name is benzyl 2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]acetate;methane.
| Compound Name | benzyl 2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]acetate;methane |
|---|---|
| PubChem CID | 157364947 |
| Molecular Formula | C30H45NO14 |
| Molecular Weight | 643.68 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | benzyl 2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]acetate;methane |
| SMILES | C.CC(=O)N[C@H]1[C@H](OCCOCCOCCOCC(=O)OCc2ccccc2)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H41NO14.CH4/c1-19(31)30-26-28(43-22(4)34)27(42-21(3)33)24(17-40-20(2)32)44-29(26)39-15-14-37-11-10-36-12-13-38-18-25(35)41-16-23-8-6-5-7-9-23;/h5-9,24,26-29H,10-18H2,1-4H3,(H,30,31);1H4/t24-,26-,27+,28-,29-;/m1./s1 |
| InChIKey | BJBLRYAUHTYCOW-RNPTUXIVSA-N |
| XLogP | 1.09 |
| TPSA | 180.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.68 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|