C27H35N3O13 — CID 101018092
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[2-[[2-[(2-benzamidoacetyl)amino]acetyl]amino]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 101018092) has the molecular formula C27H35N3O13 and a molecular weight of 609.59 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[2-[[2-[(2-benzamidoacetyl)amino]acetyl]amino]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[2-[[2-[(2-benzamidoacetyl)amino]acetyl]amino]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101018092 |
| Molecular Formula | C27H35N3O13 |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[2-[[2-[(2-benzamidoacetyl)amino]acetyl]amino]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCCNC(=O)CNC(=O)CNC(=O)c2ccccc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H35N3O13/c1-15(31)39-14-20-23(40-16(2)32)24(41-17(3)33)25(42-18(4)34)27(43-20)38-11-10-28-21(35)12-29-22(36)13-30-26(37)19-8-6-5-7-9-19/h5-9,20,23-25,27H,10-14H2,1-4H3,(H,28,35)(H,29,36)(H,30,37)/t20-,23-,24+,25+,27+/m1/s1 |
| InChIKey | DSVWXUKLUORBTM-CNKYUXFISA-N |
| XLogP | -1.25 |
| TPSA | 210.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|