C28H27ClN2O12 — CID 118184496
[(3R,5R,6R)-3,4,5-triacetyloxy-6-[2-chloro-4-(5-nitroindol-1-yl)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 118184496) has the molecular formula C28H27ClN2O12 and a molecular weight of 618.98 g/mol. Its IUPAC name is [(3R,5R,6R)-3,4,5-triacetyloxy-6-[2-chloro-4-(5-nitroindol-1-yl)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,5R,6R)-3,4,5-triacetyloxy-6-[2-chloro-4-(5-nitroindol-1-yl)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118184496 |
| Molecular Formula | C28H27ClN2O12 |
| Molecular Weight | 618.98 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | [(3R,5R,6R)-3,4,5-triacetyloxy-6-[2-chloro-4-(5-nitroindol-1-yl)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Oc2ccc(-n3ccc4cc([N+](=O)[O-])ccc43)cc2Cl)[C@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H27ClN2O12/c1-14(32)38-13-24-25(39-15(2)33)26(40-16(3)34)27(41-17(4)35)28(43-24)42-23-8-6-19(12-21(23)29)30-10-9-18-11-20(31(36)37)5-7-22(18)30/h5-12,24-28H,13H2,1-4H3/t24?,25-,26?,27-,28+/m1/s1 |
| InChIKey | OBAROPHSPCIVBQ-DNPCTHTHSA-N |
| XLogP | 3.65 |
| TPSA | 171.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.98 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|