C20H22BrClO10 — CID 75306551
[3,4,5-triacetyloxy-6-(4-bromo-2-chlorophenoxy)oxan-2-yl]methyl acetate (PubChem CID 75306551) has the molecular formula C20H22BrClO10 and a molecular weight of 537.74 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(4-bromo-2-chlorophenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(4-bromo-2-chlorophenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 75306551 |
| Molecular Formula | C20H22BrClO10 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(4-bromo-2-chlorophenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc(Br)cc2Cl)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H22BrClO10/c1-9(23)27-8-16-17(28-10(2)24)18(29-11(3)25)19(30-12(4)26)20(32-16)31-15-6-5-13(21)7-14(15)22/h5-7,16-20H,8H2,1-4H3 |
| InChIKey | DBECXJUFDNGPTL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|