C20H22BrFO10 — CID 57414265
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(4-bromo-2-fluorophenoxy)oxan-2-yl]methyl acetate (PubChem CID 57414265) has the molecular formula C20H22BrFO10 and a molecular weight of 521.29 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(4-bromo-2-fluorophenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(4-bromo-2-fluorophenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 57414265 |
| Molecular Formula | C20H22BrFO10 |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(4-bromo-2-fluorophenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Oc2ccc(Br)cc2F)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H22BrFO10/c1-9(23)27-8-16-17(28-10(2)24)18(29-11(3)25)19(30-12(4)26)20(32-16)31-15-6-5-13(21)7-14(15)22/h5-7,16-20H,8H2,1-4H3/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | IBGPUDMGAFKULH-SLHNCBLASA-N |
| XLogP | 2.05 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|