C21H25BrO10 — CID 78001871
2-[4,5-diacetyloxy-6-(acetyloxymethyl)-2-(4-bromo-2-methylphenoxy)oxan-3-yl]acetic acid (PubChem CID 78001871) has the molecular formula C21H25BrO10 and a molecular weight of 517.33 g/mol. Its IUPAC name is 2-[4,5-diacetyloxy-6-(acetyloxymethyl)-2-(4-bromo-2-methylphenoxy)oxan-3-yl]acetic acid.
| Compound Name | 2-[4,5-diacetyloxy-6-(acetyloxymethyl)-2-(4-bromo-2-methylphenoxy)oxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 78001871 |
| Molecular Formula | C21H25BrO10 |
| Molecular Weight | 517.33 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | 2-[4,5-diacetyloxy-6-(acetyloxymethyl)-2-(4-bromo-2-methylphenoxy)oxan-3-yl]acetic acid |
| SMILES | CC(=O)OCC1OC(Oc2ccc(Br)cc2C)C(CC(=O)O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H25BrO10/c1-10-7-14(22)5-6-16(10)31-21-15(8-18(26)27)19(29-12(3)24)20(30-13(4)25)17(32-21)9-28-11(2)23/h5-7,15,17,19-21H,8-9H2,1-4H3,(H,26,27) |
| InChIKey | DCYVHSZMFLHEKF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|