C21H25ClO11 — CID 139829257
[(2R,3S,4S,5R)-6-[2-chloro-4-(hydroxymethyl)phenoxy]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 139829257) has the molecular formula C21H25ClO11 and a molecular weight of 492.90 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-6-[2-chloro-4-(hydroxymethyl)phenoxy]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3S,4S,5R)-6-[2-chloro-4-(hydroxymethyl)phenoxy]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 139829257 |
| Molecular Formula | C21H25ClO11 |
| Molecular Weight | 492.90 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | [(2R,3S,4S,5R)-6-[2-chloro-4-(hydroxymethyl)phenoxy]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(Oc2ccc(CO)cc2Cl)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C21H25ClO11/c1-10(24)28-9-17-18(29-11(2)25)19(30-12(3)26)20(31-13(4)27)21(33-17)32-16-6-5-14(8-23)7-15(16)22/h5-7,17-21,23H,8-9H2,1-4H3/t17-,18+,19+,20-,21?/m1/s1/i1D,2D,3D,4D |
| InChIKey | MPTINMUIQJABQY-KIPFYTNGSA-N |
| XLogP | 1.29 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.90 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|