C27H28ClN3O10 — CID 118601723
[(3R,6R)-3,4,5-triacetyloxy-6-[2-chloro-4-(3-methylimidazo[4,5-b]pyridin-6-yl)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 118601723) has the molecular formula C27H28ClN3O10 and a molecular weight of 589.99 g/mol. Its IUPAC name is [(3R,6R)-3,4,5-triacetyloxy-6-[2-chloro-4-(3-methylimidazo[4,5-b]pyridin-6-yl)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,4,5-triacetyloxy-6-[2-chloro-4-(3-methylimidazo[4,5-b]pyridin-6-yl)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118601723 |
| Molecular Formula | C27H28ClN3O10 |
| Molecular Weight | 589.99 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | [(3R,6R)-3,4,5-triacetyloxy-6-[2-chloro-4-(3-methylimidazo[4,5-b]pyridin-6-yl)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Oc2ccc(-c3cnc4c(c3)ncn4C)cc2Cl)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H28ClN3O10/c1-13(32)36-11-22-23(37-14(2)33)24(38-15(3)34)25(39-16(4)35)27(41-22)40-21-7-6-17(8-19(21)28)18-9-20-26(29-10-18)31(5)12-30-20/h6-10,12,22-25,27H,11H2,1-5H3/t22?,23-,24?,25?,27+/m1/s1 |
| InChIKey | FJAYIAWCKILOLX-CEVGUIHQSA-N |
| XLogP | 2.75 |
| TPSA | 154.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.99 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|