C22H26BrClO10 — CID 56614374
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(2-bromoethyl)-2-chlorophenoxy]oxan-2-yl]methyl acetate (PubChem CID 56614374) has the molecular formula C22H26BrClO10 and a molecular weight of 565.80 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(2-bromoethyl)-2-chlorophenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(2-bromoethyl)-2-chlorophenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 56614374 |
| Molecular Formula | C22H26BrClO10 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(2-bromoethyl)-2-chlorophenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Oc2ccc(CCBr)cc2Cl)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H26BrClO10/c1-11(25)29-10-18-19(30-12(2)26)20(31-13(3)27)21(32-14(4)28)22(34-18)33-17-6-5-15(7-8-23)9-16(17)24/h5-6,9,18-22H,7-8,10H2,1-4H3/t18-,19+,20+,21-,22+/m1/s1 |
| InChIKey | FXVYGUHXSQXHTI-CTWRKMMKSA-N |
| XLogP | 2.74 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|