C21H22N2O9 — CID 70933904
(3S,4S,6R)-2-(hydroxymethyl)-6-[2-methoxy-4-(5-nitroindol-1-yl)phenoxy]oxane-3,4,5-triol (PubChem CID 70933904) has the molecular formula C21H22N2O9 and a molecular weight of 446.41 g/mol. Its IUPAC name is (3S,4S,6R)-2-(hydroxymethyl)-6-[2-methoxy-4-(5-nitroindol-1-yl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (3S,4S,6R)-2-(hydroxymethyl)-6-[2-methoxy-4-(5-nitroindol-1-yl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70933904 |
| Molecular Formula | C21H22N2O9 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (3S,4S,6R)-2-(hydroxymethyl)-6-[2-methoxy-4-(5-nitroindol-1-yl)phenoxy]oxane-3,4,5-triol |
| SMILES | COc1cc(-n2ccc3cc([N+](=O)[O-])ccc32)ccc1O[C@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C21H22N2O9/c1-30-16-9-12(22-7-6-11-8-13(23(28)29)2-4-14(11)22)3-5-15(16)31-21-20(27)19(26)18(25)17(10-24)32-21/h2-9,17-21,24-27H,10H2,1H3/t17?,18-,19+,20?,21+/m1/s1 |
| InChIKey | FISIQEFCCCFHDL-JRXKHZKBSA-N |
| XLogP | 0.73 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|