About 5-nitro-1-(3,4,5-trimethoxyphenyl)indole
5-nitro-1-(3,4,5-trimethoxyphenyl)indole (PubChem CID 139938209) has the molecular formula C17H16N2O5
and a molecular weight of 328.32 g/mol. Its IUPAC name is 5-nitro-1-(3,4,5-trimethoxyphenyl)indole.
Molecular Properties
| Compound Name | 5-nitro-1-(3,4,5-trimethoxyphenyl)indole |
| PubChem CID | 139938209 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-nitro-1-(3,4,5-trimethoxyphenyl)indole |
| SMILES | COc1cc(-n2ccc3cc([N+](=O)[O-])ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C17H16N2O5/c1-22-15-9-13(10-16(23-2)17(15)24-3)18-7-6-11-8-12(19(20)21)4-5-14(11)18/h4-10H,1-3H3 |
| InChIKey | LPFYNZAITIZVEZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1-(3,4,5-trimethoxyphenyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1-(3,4,5-trimethoxyphenyl)indole?
The IUPAC name of 5-nitro-1-(3,4,5-trimethoxyphenyl)indole (CID 139938209) is 5-nitro-1-(3,4,5-trimethoxyphenyl)indole.
What is the SMILES notation for 5-nitro-1-(3,4,5-trimethoxyphenyl)indole?
The canonical SMILES for 5-nitro-1-(3,4,5-trimethoxyphenyl)indole is COc1cc(-n2ccc3cc([N+](=O)[O-])ccc32)cc(OC)c1OC.
What is the InChIKey of 5-nitro-1-(3,4,5-trimethoxyphenyl)indole?
The InChIKey is LPFYNZAITIZVEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O5/c1-22-15-9-13(10-16(23-2)17(15)24-3)18-7-6-11-8-12(19(20)21)4-5-14(11)18/h4-10H,1-3H3.
What are the key properties of 5-nitro-1-(3,4,5-trimethoxyphenyl)indole?
5-nitro-1-(3,4,5-trimethoxyphenyl)indole has a molecular weight of 328.32 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1-(3,4,5-trimethoxyphenyl)indole is sourced from PubChem (CID 139938209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).