C15H15N3O7 — CID 9279315
N-(2,4-dinitrophenyl)-3,4,5-trimethoxyaniline (PubChem CID 9279315) has the molecular formula C15H15N3O7 and a molecular weight of 349.30 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-3,4,5-trimethoxyaniline.
| Compound Name | N-(2,4-dinitrophenyl)-3,4,5-trimethoxyaniline |
|---|---|
| PubChem CID | 9279315 |
| Molecular Formula | C15H15N3O7 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-(2,4-dinitrophenyl)-3,4,5-trimethoxyaniline |
| SMILES | COc1cc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C15H15N3O7/c1-23-13-6-9(7-14(24-2)15(13)25-3)16-11-5-4-10(17(19)20)8-12(11)18(21)22/h4-8,16H,1-3H3 |
| InChIKey | CNFDFCXKCKKTBI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|