C14H13N3O5 — CID 141052609
1-[4-(2,4-dinitroanilino)phenyl]ethanol (PubChem CID 141052609) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is 1-[4-(2,4-dinitroanilino)phenyl]ethanol.
| Compound Name | 1-[4-(2,4-dinitroanilino)phenyl]ethanol |
|---|---|
| PubChem CID | 141052609 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-[4-(2,4-dinitroanilino)phenyl]ethanol |
| SMILES | CC(O)c1ccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H13N3O5/c1-9(18)10-2-4-11(5-3-10)15-13-7-6-12(16(19)20)8-14(13)17(21)22/h2-9,15,18H,1H3 |
| InChIKey | SZXRLAQSTPMDBE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|