C16H12N4O7 — CID 5333554
(Z)-4-[4-(2,4-dinitroanilino)anilino]-4-oxobut-2-enoic acid (PubChem CID 5333554) has the molecular formula C16H12N4O7 and a molecular weight of 372.29 g/mol. Its IUPAC name is (Z)-4-[4-(2,4-dinitroanilino)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-(2,4-dinitroanilino)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 5333554 |
| Molecular Formula | C16H12N4O7 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (Z)-4-[4-(2,4-dinitroanilino)anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12N4O7/c21-15(7-8-16(22)23)18-11-3-1-10(2-4-11)17-13-6-5-12(19(24)25)9-14(13)20(26)27/h1-9,17H,(H,18,21)(H,22,23)/b8-7- |
| InChIKey | CINWJNUJCYISJS-FPLPWBNLSA-N |
| XLogP | 2.83 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|