C11H9N3O7 — CID 5356553
(Z)-4-(4-methyl-3,5-dinitroanilino)-4-oxobut-2-enoic acid (PubChem CID 5356553) has the molecular formula C11H9N3O7 and a molecular weight of 295.21 g/mol. Its IUPAC name is (Z)-4-(4-methyl-3,5-dinitroanilino)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(4-methyl-3,5-dinitroanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 5356553 |
| Molecular Formula | C11H9N3O7 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (Z)-4-(4-methyl-3,5-dinitroanilino)-4-oxobut-2-enoic acid |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)/C=C\C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9N3O7/c1-6-8(13(18)19)4-7(5-9(6)14(20)21)12-10(15)2-3-11(16)17/h2-5H,1H3,(H,12,15)(H,16,17)/b3-2- |
| InChIKey | NVHUSKIIOCPXRK-IHWYPQMZSA-N |
| XLogP | 1.39 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|