C12H11N2O5- — CID 7218076
4-(4,5-dimethyl-2-nitroanilino)-4-oxobut-2-enoate (PubChem CID 7218076) has the molecular formula C12H11N2O5- and a molecular weight of 263.23 g/mol. Its IUPAC name is 4-(4,5-dimethyl-2-nitroanilino)-4-oxobut-2-enoate.
| Compound Name | 4-(4,5-dimethyl-2-nitroanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7218076 |
| Molecular Formula | C12H11N2O5- |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-(4,5-dimethyl-2-nitroanilino)-4-oxobut-2-enoate |
| SMILES | Cc1cc(NC(=O)C=CC(=O)[O-])c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C12H12N2O5/c1-7-5-9(10(14(18)19)6-8(7)2)13-11(15)3-4-12(16)17/h3-6H,1-2H3,(H,13,15)(H,16,17)/p-1 |
| InChIKey | ONTMQGIJPCFGIS-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|