C14H13BrN2O3S — CID 79987721
5-bromo-N-(4,5-dimethyl-2-nitrophenyl)-4-methylthiophene-2-carboxamide (PubChem CID 79987721) has the molecular formula C14H13BrN2O3S and a molecular weight of 369.24 g/mol. Its IUPAC name is 5-bromo-N-(4,5-dimethyl-2-nitrophenyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(4,5-dimethyl-2-nitrophenyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79987721 |
| Molecular Formula | C14H13BrN2O3S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 5-bromo-N-(4,5-dimethyl-2-nitrophenyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(C)c(Br)s2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H13BrN2O3S/c1-7-4-10(11(17(19)20)5-8(7)2)16-14(18)12-6-9(3)13(15)21-12/h4-6H,1-3H3,(H,16,18) |
| InChIKey | JXDRTRAMAFTQOM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|