C10H13N3O3 — CID 115579896
1-(4,5-dimethyl-2-nitrophenyl)-3-methylurea (PubChem CID 115579896) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-nitrophenyl)-3-methylurea.
| Compound Name | 1-(4,5-dimethyl-2-nitrophenyl)-3-methylurea |
|---|---|
| PubChem CID | 115579896 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-(4,5-dimethyl-2-nitrophenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1cc(C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O3/c1-6-4-8(12-10(14)11-3)9(13(15)16)5-7(6)2/h4-5H,1-3H3,(H2,11,12,14) |
| InChIKey | VKQNBAJYAIHXDP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|