C14H19N3O3 — CID 116677616
2-(azetidin-3-yl)-N-(4,5-dimethyl-2-nitrophenyl)propanamide (PubChem CID 116677616) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-(4,5-dimethyl-2-nitrophenyl)propanamide.
| Compound Name | 2-(azetidin-3-yl)-N-(4,5-dimethyl-2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 116677616 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-(azetidin-3-yl)-N-(4,5-dimethyl-2-nitrophenyl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)C2CNC2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H19N3O3/c1-8-4-12(13(17(19)20)5-9(8)2)16-14(18)10(3)11-6-15-7-11/h4-5,10-11,15H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | LKERWNVHGHIKMA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|