C14H19N3O2 — CID 116675477
4-[2-(azetidin-3-yl)propanoylamino]-3-methylbenzamide (PubChem CID 116675477) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 4-[2-(azetidin-3-yl)propanoylamino]-3-methylbenzamide.
| Compound Name | 4-[2-(azetidin-3-yl)propanoylamino]-3-methylbenzamide |
|---|---|
| PubChem CID | 116675477 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[2-(azetidin-3-yl)propanoylamino]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1NC(=O)C(C)C1CNC1 |
| InChI | InChI=1S/C14H19N3O2/c1-8-5-10(13(15)18)3-4-12(8)17-14(19)9(2)11-6-16-7-11/h3-5,9,11,16H,6-7H2,1-2H3,(H2,15,18)(H,17,19) |
| InChIKey | JZPLSHBMTXZYIO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |